ethyl 4-(3,4-dimethoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 4-(3,4-dimethoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
ethyl 4-(3,4-dimethoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | 1309-1348 |
| Compound Name: | ethyl 4-(3,4-dimethoxyphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 320.34 |
| Molecular Formula: | C16 H20 N2 O5 |
| Smiles: | CCOC(C1C(c2ccc(c(c2)OC)OC)NC(NC=1C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3064 |
| logD: | 1.1562 |
| logSw: | -2.0388 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.706 |
| InChI Key: | OBEBHPPWYNUWBE-CQSZACIVSA-N |