N-[1-(2-chlorophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide
Chemical Structure Depiction of
N-[1-(2-chlorophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide
N-[1-(2-chlorophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide
Compound characteristics
| Compound ID: | 1309-1656 |
| Compound Name: | N-[1-(2-chlorophenyl)-3-(4-methoxyanilino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| Molecular Weight: | 420.89 |
| Molecular Formula: | C24 H21 Cl N2 O3 |
| Smiles: | Cc1ccc(cc1)C(NC(=C\c1ccccc1[Cl])\C(Nc1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2259 |
| logD: | 4.6285 |
| logSw: | -5.7856 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.798 |
| InChI Key: | JKWZSDOJMHSMCV-UHFFFAOYSA-N |