ethyl 6-(chloromethyl)-2-oxo-4-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 6-(chloromethyl)-2-oxo-4-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate
ethyl 6-(chloromethyl)-2-oxo-4-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | 1309-1801 |
| Compound Name: | ethyl 6-(chloromethyl)-2-oxo-4-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 294.74 |
| Molecular Formula: | C14 H15 Cl N2 O3 |
| Smiles: | CCOC(C1C(c2ccccc2)NC(NC=1C[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.003 |
| logD: | 0.7324 |
| logSw: | -2.3874 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.052 |
| InChI Key: | BJYPUOCKWBTIGT-GFCCVEGCSA-N |