2-[(4-chlorophenyl)methylidene]-6-[(4-methylphenyl)methylidene]cyclohexan-1-one
Chemical Structure Depiction of
2-[(4-chlorophenyl)methylidene]-6-[(4-methylphenyl)methylidene]cyclohexan-1-one
2-[(4-chlorophenyl)methylidene]-6-[(4-methylphenyl)methylidene]cyclohexan-1-one
Compound characteristics
| Compound ID: | 1310-0217 |
| Compound Name: | 2-[(4-chlorophenyl)methylidene]-6-[(4-methylphenyl)methylidene]cyclohexan-1-one |
| Molecular Weight: | 322.83 |
| Molecular Formula: | C21 H19 Cl O |
| Smiles: | Cc1ccc(\C=C2/CCC/C(=C\c3ccc(cc3)[Cl])C2=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.0995 |
| logD: | 6.0995 |
| logSw: | -6.3506 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 13.0339 |
| InChI Key: | QOKNXIAPRMGJDX-UHFFFAOYSA-N |