N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]-4-methoxy-3-nitrobenzamide
Chemical Structure Depiction of
N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]-4-methoxy-3-nitrobenzamide
N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]-4-methoxy-3-nitrobenzamide
Compound characteristics
| Compound ID: | 1315-0144 |
| Compound Name: | N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]-4-methoxy-3-nitrobenzamide |
| Molecular Weight: | 423.81 |
| Molecular Formula: | C21 H14 Cl N3 O5 |
| Smiles: | COc1ccc(cc1[N+]([O-])=O)C(Nc1ccc2c(c1)nc(c1ccccc1[Cl])o2)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4516 |
| logD: | 4.4434 |
| logSw: | -4.6006 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.851 |
| InChI Key: | KFAVTCOUNVKAPK-UHFFFAOYSA-N |