1-(4-chloro-3-nitrophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine
Chemical Structure Depiction of
1-(4-chloro-3-nitrophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine
1-(4-chloro-3-nitrophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine
Compound characteristics
| Compound ID: | 1315-0420 |
| Compound Name: | 1-(4-chloro-3-nitrophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine |
| Molecular Weight: | 446.67 |
| Molecular Formula: | C20 H10 Cl3 N3 O3 |
| Smiles: | C(\c1ccc(c(c1)[N+]([O-])=O)[Cl])=N/c1ccc2c(c1)nc(c1ccc(cc1[Cl])[Cl])o2 |
| Stereo: | ACHIRAL |
| logP: | 6.1974 |
| logD: | 6.1974 |
| logSw: | -6.6071 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.257 |
| InChI Key: | RRYSWENITSUWEL-UHFFFAOYSA-N |