N'-(2,4,4,5,5-pentachloro-3-oxocyclopent-1-en-1-yl)benzohydrazide
Chemical Structure Depiction of
N'-(2,4,4,5,5-pentachloro-3-oxocyclopent-1-en-1-yl)benzohydrazide
N'-(2,4,4,5,5-pentachloro-3-oxocyclopent-1-en-1-yl)benzohydrazide
Compound characteristics
| Compound ID: | 1321-2077 |
| Compound Name: | N'-(2,4,4,5,5-pentachloro-3-oxocyclopent-1-en-1-yl)benzohydrazide |
| Molecular Weight: | 388.46 |
| Molecular Formula: | C12 H7 Cl5 N2 O2 |
| Smiles: | c1ccc(cc1)C(NNC1=C(C(C(C1([Cl])[Cl])([Cl])[Cl])=O)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.9224 |
| logD: | -1.9554 |
| logSw: | -4.4144 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.16 |
| InChI Key: | YCBPJLYXDRAULQ-UHFFFAOYSA-N |