ethyl 2-{1,4-bis[(benzenesulfonyl)amino]naphthalen-2-yl}-3-oxobutanoate
Chemical Structure Depiction of
ethyl 2-{1,4-bis[(benzenesulfonyl)amino]naphthalen-2-yl}-3-oxobutanoate
ethyl 2-{1,4-bis[(benzenesulfonyl)amino]naphthalen-2-yl}-3-oxobutanoate
Compound characteristics
| Compound ID: | 1325-0056 |
| Compound Name: | ethyl 2-{1,4-bis[(benzenesulfonyl)amino]naphthalen-2-yl}-3-oxobutanoate |
| Molecular Weight: | 566.65 |
| Molecular Formula: | C28 H26 N2 O7 S2 |
| Smiles: | CCOC(C(C(C)=O)c1cc(c2ccccc2c1NS(c1ccccc1)(=O)=O)NS(c1ccccc1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2819 |
| logD: | 3.9794 |
| logSw: | -4.2369 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 113.753 |
| InChI Key: | GRBLAFMRDKOAHM-AREMUKBSSA-N |