ethyl {2-[(2-{[2-methyl-5-(propan-2-yl)phenoxy]acetyl}hydrazinylidene)methyl]phenoxy}acetate
Chemical Structure Depiction of
ethyl {2-[(2-{[2-methyl-5-(propan-2-yl)phenoxy]acetyl}hydrazinylidene)methyl]phenoxy}acetate
ethyl {2-[(2-{[2-methyl-5-(propan-2-yl)phenoxy]acetyl}hydrazinylidene)methyl]phenoxy}acetate
Compound characteristics
| Compound ID: | 1348-1281 |
| Compound Name: | ethyl {2-[(2-{[2-methyl-5-(propan-2-yl)phenoxy]acetyl}hydrazinylidene)methyl]phenoxy}acetate |
| Molecular Weight: | 412.49 |
| Molecular Formula: | C23 H28 N2 O5 |
| Smiles: | [H]N(C(COc1cc(ccc1C)C(C)C)=O)/N=C/c1ccccc1OCC(=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 4.9614 |
| logD: | 4.9614 |
| logSw: | -4.5843 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.671 |
| InChI Key: | ASLIVPYHPUSMRU-UHFFFAOYSA-N |