2-methoxy-4-{[(1H-1,2,4-triazol-1-yl)imino]methyl}phenol
Chemical Structure Depiction of
2-methoxy-4-{[(1H-1,2,4-triazol-1-yl)imino]methyl}phenol
2-methoxy-4-{[(1H-1,2,4-triazol-1-yl)imino]methyl}phenol
Compound characteristics
| Compound ID: | 1355-0046 |
| Compound Name: | 2-methoxy-4-{[(1H-1,2,4-triazol-1-yl)imino]methyl}phenol |
| Molecular Weight: | 218.21 |
| Molecular Formula: | C10 H10 N4 O2 |
| Smiles: | COc1cc(/C=N/n2cncn2)ccc1O |
| Stereo: | ACHIRAL |
| logP: | 0.098 |
| logD: | 0.095 |
| logSw: | -1.2254 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.362 |
| InChI Key: | HNHLTCCXORTFEC-LFYBBSHMSA-N |