1,1'-(3,5-dimethyl-1H-pyrrole-2,4-diyl)di(ethan-1-one)
Chemical Structure Depiction of
1,1'-(3,5-dimethyl-1H-pyrrole-2,4-diyl)di(ethan-1-one)
1,1'-(3,5-dimethyl-1H-pyrrole-2,4-diyl)di(ethan-1-one)
Compound characteristics
| Compound ID: | 1363-0040 |
| Compound Name: | 1,1'-(3,5-dimethyl-1H-pyrrole-2,4-diyl)di(ethan-1-one) |
| Molecular Weight: | 179.22 |
| Molecular Formula: | C10 H13 N O2 |
| Smiles: | CC(c1c(C)c(C(C)=O)[nH]c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1962 |
| logD: | 1.1962 |
| logSw: | -0.9961 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.873 |
| InChI Key: | QQDLJFDTROVUDP-UHFFFAOYSA-N |