1,3,4,6-tetra-O-acetyl-2-butanamido-2-deoxyhexopyranose
Chemical Structure Depiction of
1,3,4,6-tetra-O-acetyl-2-butanamido-2-deoxyhexopyranose
1,3,4,6-tetra-O-acetyl-2-butanamido-2-deoxyhexopyranose
Compound characteristics
| Compound ID: | 1419-0004 |
| Compound Name: | 1,3,4,6-tetra-O-acetyl-2-butanamido-2-deoxyhexopyranose |
| Molecular Weight: | 417.41 |
| Molecular Formula: | C18 H27 N O10 |
| Smiles: | [H]C1(C([H])(C([H])(C([H])(COC(C)=O)OC1([H])OC(C)=O)OC(C)=O)OC(C)=O)NC(CCC)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 0.7073 |
| logD: | 0.7073 |
| logSw: | -1.0755 |
| Hydrogen bond acceptors count: | 15 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 116.774 |
| InChI Key: | WXTMNEIVBVUCNI-UHFFFAOYSA-N |