1-(adamantan-1-yl)-2-iodoethan-1-ol
Chemical Structure Depiction of
1-(adamantan-1-yl)-2-iodoethan-1-ol
1-(adamantan-1-yl)-2-iodoethan-1-ol
Compound characteristics
| Compound ID: | 1438-0051 |
| Compound Name: | 1-(adamantan-1-yl)-2-iodoethan-1-ol |
| Molecular Weight: | 306.18 |
| Molecular Formula: | C12 H19 I O |
| Smiles: | C1C2CC3CC1CC(C2)(C3)C(CI)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4478 |
| logD: | 3.4478 |
| logSw: | -3.1503 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 16.4238 |
| InChI Key: | HMUJKIIGGWBFIF-CRCJWISWSA-N |