8-[2-(3-ethylphenyl)hydrazinylidene]-4-methyl-2H-furo[2,3-h][1]benzopyran-2,9(8H)-dione
Chemical Structure Depiction of
8-[2-(3-ethylphenyl)hydrazinylidene]-4-methyl-2H-furo[2,3-h][1]benzopyran-2,9(8H)-dione
8-[2-(3-ethylphenyl)hydrazinylidene]-4-methyl-2H-furo[2,3-h][1]benzopyran-2,9(8H)-dione
Compound characteristics
| Compound ID: | 1440-2878 |
| Compound Name: | 8-[2-(3-ethylphenyl)hydrazinylidene]-4-methyl-2H-furo[2,3-h][1]benzopyran-2,9(8H)-dione |
| Molecular Weight: | 348.36 |
| Molecular Formula: | C20 H16 N2 O4 |
| Smiles: | CCc1cccc(c1)N/N=C1\C(c2c(ccc3C(C)=CC(=O)Oc23)O1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1666 |
| logD: | 4.1665 |
| logSw: | -4.4633 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.517 |
| InChI Key: | AEOXNEKNUJIZRP-UHFFFAOYSA-N |