N'-{[4-(propan-2-yl)phenyl]methylidene}pyridine-3-carbohydrazide
Chemical Structure Depiction of
N'-{[4-(propan-2-yl)phenyl]methylidene}pyridine-3-carbohydrazide
N'-{[4-(propan-2-yl)phenyl]methylidene}pyridine-3-carbohydrazide
Compound characteristics
| Compound ID: | 1447-2103 |
| Compound Name: | N'-{[4-(propan-2-yl)phenyl]methylidene}pyridine-3-carbohydrazide |
| Molecular Weight: | 267.33 |
| Molecular Formula: | C16 H17 N3 O |
| Smiles: | CC(C)c1ccc(/C=N/NC(c2cccnc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.1144 |
| logD: | 3.0962 |
| logSw: | -3.0444 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.072 |
| InChI Key: | GSUDPPFEUOXWMY-UHFFFAOYSA-N |