{5-[(3-ethoxy-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetic acid
Chemical Structure Depiction of
{5-[(3-ethoxy-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetic acid
{5-[(3-ethoxy-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetic acid
Compound characteristics
| Compound ID: | 1464-0110 |
| Compound Name: | {5-[(3-ethoxy-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetic acid |
| Molecular Weight: | 353.41 |
| Molecular Formula: | C15 H15 N O5 S2 |
| Smiles: | CCOc1cc(\C=C2/C(N(CC(O)=O)C(=S)S2)=O)ccc1OC |
| Stereo: | ACHIRAL |
| logP: | 0.9902 |
| logD: | -2.1288 |
| logSw: | -2.2363 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.938 |
| InChI Key: | CWCOIGKZYRXEEV-UHFFFAOYSA-N |