4-{[2-(3-methyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl}phenyl 4-tert-butylbenzoate
Chemical Structure Depiction of
4-{[2-(3-methyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl}phenyl 4-tert-butylbenzoate
4-{[2-(3-methyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl}phenyl 4-tert-butylbenzoate
Compound characteristics
| Compound ID: | 1469-0051 |
| Compound Name: | 4-{[2-(3-methyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl}phenyl 4-tert-butylbenzoate |
| Molecular Weight: | 404.47 |
| Molecular Formula: | C23 H24 N4 O3 |
| Smiles: | Cc1cc(C(N/N=C/c2ccc(cc2)OC(c2ccc(cc2)C(C)(C)C)=O)=O)[nH]n1 |
| Stereo: | ACHIRAL |
| logP: | 4.777 |
| logD: | 4.7751 |
| logSw: | -4.6069 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.5 |
| InChI Key: | YVKYGTKHHNKYSP-UHFFFAOYSA-N |