N~1~,N~4~-di([1,1'-biphenyl]-4-yl)benzene-1,4-dicarboxamide
Chemical Structure Depiction of
N~1~,N~4~-di([1,1'-biphenyl]-4-yl)benzene-1,4-dicarboxamide
N~1~,N~4~-di([1,1'-biphenyl]-4-yl)benzene-1,4-dicarboxamide
Compound characteristics
| Compound ID: | 1473-0106 |
| Compound Name: | N~1~,N~4~-di([1,1'-biphenyl]-4-yl)benzene-1,4-dicarboxamide |
| Molecular Weight: | 468.56 |
| Molecular Formula: | C32 H24 N2 O2 |
| Smiles: | c1ccc(cc1)c1ccc(cc1)NC(c1ccc(cc1)C(Nc1ccc(cc1)c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.2894 |
| logD: | 7.2893 |
| logSw: | -6.4925 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.878 |
| InChI Key: | GOKNUSPOJKLDHU-UHFFFAOYSA-N |