2-[(2-methylphenyl)methyl]butanedioic acid
Chemical Structure Depiction of
2-[(2-methylphenyl)methyl]butanedioic acid
2-[(2-methylphenyl)methyl]butanedioic acid
Compound characteristics
| Compound ID: | 1482-0005 |
| Compound Name: | 2-[(2-methylphenyl)methyl]butanedioic acid |
| Molecular Weight: | 222.24 |
| Molecular Formula: | C12 H14 O4 |
| Smiles: | Cc1ccccc1CC(CC(O)=O)C(O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.0829 |
| logD: | -1.8914 |
| logSw: | -1.5049 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.03 |
| InChI Key: | WFWVINOHIVDSEV-SNVBAGLBSA-N |