2-[(3,5-dimethylphenyl)methyl]butanedioic acid
Chemical Structure Depiction of
2-[(3,5-dimethylphenyl)methyl]butanedioic acid
2-[(3,5-dimethylphenyl)methyl]butanedioic acid
Compound characteristics
| Compound ID: | 1482-0011 |
| Compound Name: | 2-[(3,5-dimethylphenyl)methyl]butanedioic acid |
| Molecular Weight: | 236.27 |
| Molecular Formula: | C13 H16 O4 |
| Smiles: | Cc1cc(C)cc(CC(CC(O)=O)C(O)=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7819 |
| logD: | -1.1924 |
| logSw: | -1.5599 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.03 |
| InChI Key: | OSVJWRCCUIXRAQ-LLVKDONJSA-N |