2-(benzylsulfanyl)-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole
Chemical Structure Depiction of
2-(benzylsulfanyl)-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole
2-(benzylsulfanyl)-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole
Compound characteristics
| Compound ID: | 1482-0212 |
| Compound Name: | 2-(benzylsulfanyl)-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole |
| Molecular Weight: | 337.22 |
| Molecular Formula: | C15 H10 Cl2 N2 O S |
| Smiles: | C(c1ccccc1)Sc1nnc(c2ccc(cc2[Cl])[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 4.442 |
| logD: | 4.442 |
| logSw: | -4.6995 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.0641 |
| InChI Key: | DAWVIXYYTGKMBG-UHFFFAOYSA-N |