N-[1-(2-fluorophenyl)-3-(methylamino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide
Chemical Structure Depiction of
N-[1-(2-fluorophenyl)-3-(methylamino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide
N-[1-(2-fluorophenyl)-3-(methylamino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide
Compound characteristics
| Compound ID: | 1490-0649 |
| Compound Name: | N-[1-(2-fluorophenyl)-3-(methylamino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| Molecular Weight: | 312.34 |
| Molecular Formula: | C18 H17 F N2 O2 |
| Smiles: | Cc1ccc(cc1)C(NC(=C\c1ccccc1F)\C(NC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8619 |
| logD: | 0.835 |
| logSw: | -3.3838 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 46.998 |
| InChI Key: | NONJPWADKUJKRW-UHFFFAOYSA-N |