5-[(4-carboxyphenyl)sulfamoyl]-2-hydroxybenzoic acid
Chemical Structure Depiction of
5-[(4-carboxyphenyl)sulfamoyl]-2-hydroxybenzoic acid
5-[(4-carboxyphenyl)sulfamoyl]-2-hydroxybenzoic acid
Compound characteristics
| Compound ID: | 1494-0562 |
| Compound Name: | 5-[(4-carboxyphenyl)sulfamoyl]-2-hydroxybenzoic acid |
| Molecular Weight: | 337.31 |
| Molecular Formula: | C14 H11 N O7 S |
| Smiles: | c1cc(ccc1C(O)=O)NS(c1ccc(c(c1)C(O)=O)O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.025 |
| logD: | -2.6068 |
| logSw: | -3.4125 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 114.252 |
| InChI Key: | VUULETIZQLXZDJ-UHFFFAOYSA-N |