1-[(2,4,4-trimethylpentan-2-yl)amino]-3-(2,4,6-trimethylphenoxy)propan-2-ol--hydrogen chloride (1/1)
Chemical Structure Depiction of
1-[(2,4,4-trimethylpentan-2-yl)amino]-3-(2,4,6-trimethylphenoxy)propan-2-ol--hydrogen chloride (1/1)
1-[(2,4,4-trimethylpentan-2-yl)amino]-3-(2,4,6-trimethylphenoxy)propan-2-ol--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 1495-0129 |
| Compound Name: | 1-[(2,4,4-trimethylpentan-2-yl)amino]-3-(2,4,6-trimethylphenoxy)propan-2-ol--hydrogen chloride (1/1) |
| Molecular Weight: | 357.96 |
| Molecular Formula: | C20 H35 N O2 |
| Salt: | HCl |
| Smiles: | Cc1cc(C)c(c(C)c1)OCC(CNC(C)(C)CC(C)(C)C)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4036 |
| logD: | 2.9795 |
| logSw: | -5.4427 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.65 |
| InChI Key: | RPHSSDPQHQPIOG-KRWDZBQOSA-N |