2-[4-(adamantan-1-yl)phenoxy]-N'-[(4-nitrophenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-[4-(adamantan-1-yl)phenoxy]-N'-[(4-nitrophenyl)methylidene]acetohydrazide
2-[4-(adamantan-1-yl)phenoxy]-N'-[(4-nitrophenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 1495-0224 |
| Compound Name: | 2-[4-(adamantan-1-yl)phenoxy]-N'-[(4-nitrophenyl)methylidene]acetohydrazide |
| Molecular Weight: | 433.51 |
| Molecular Formula: | C25 H27 N3 O4 |
| Smiles: | [H]C(/c1ccc(cc1)[N+]([O-])=O)=N/NC(COc1ccc(cc1)C12CC3CC(CC(C3)C2)C1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9517 |
| logD: | 5.9513 |
| logSw: | -6.0463 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.983 |
| InChI Key: | GJHINQUFMHRRGL-UHFFFAOYSA-N |