N-[2,2,2-trichloro-1-(2-chloroanilino)ethyl]pyridine-3-carboxamide
Chemical Structure Depiction of
N-[2,2,2-trichloro-1-(2-chloroanilino)ethyl]pyridine-3-carboxamide
N-[2,2,2-trichloro-1-(2-chloroanilino)ethyl]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | 1501-0600 |
| Compound Name: | N-[2,2,2-trichloro-1-(2-chloroanilino)ethyl]pyridine-3-carboxamide |
| Molecular Weight: | 379.07 |
| Molecular Formula: | C14 H11 Cl4 N3 O |
| Smiles: | c1ccc(c(c1)NC(C([Cl])([Cl])[Cl])NC(c1cccnc1)=O)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1889 |
| logD: | 2.7743 |
| logSw: | -3.5617 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.27 |
| InChI Key: | ZXQNUOSILKBVBP-CYBMUJFWSA-N |