4-bromo-N-{2,2,2-trichloro-1-[2-chloro-5-(trifluoromethyl)anilino]ethyl}benzamide
Chemical Structure Depiction of
4-bromo-N-{2,2,2-trichloro-1-[2-chloro-5-(trifluoromethyl)anilino]ethyl}benzamide
4-bromo-N-{2,2,2-trichloro-1-[2-chloro-5-(trifluoromethyl)anilino]ethyl}benzamide
Compound characteristics
| Compound ID: | 1501-0956 |
| Compound Name: | 4-bromo-N-{2,2,2-trichloro-1-[2-chloro-5-(trifluoromethyl)anilino]ethyl}benzamide |
| Molecular Weight: | 524.98 |
| Molecular Formula: | C16 H10 Br Cl4 F3 N2 O |
| Smiles: | c1cc(ccc1C(NC(C([Cl])([Cl])[Cl])Nc1cc(ccc1[Cl])C(F)(F)F)=O)[Br] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.252 |
| logD: | 5.3857 |
| logSw: | -6.5512 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 32.752 |
| InChI Key: | LRWIWPWHCUQSBM-CQSZACIVSA-N |