N-{2,2,2-tribromo-1-[(naphthalen-1-yl)amino]ethyl}benzamide
Chemical Structure Depiction of
N-{2,2,2-tribromo-1-[(naphthalen-1-yl)amino]ethyl}benzamide
N-{2,2,2-tribromo-1-[(naphthalen-1-yl)amino]ethyl}benzamide
Compound characteristics
| Compound ID: | 1502-0086 |
| Compound Name: | N-{2,2,2-tribromo-1-[(naphthalen-1-yl)amino]ethyl}benzamide |
| Molecular Weight: | 527.05 |
| Molecular Formula: | C19 H15 Br3 N2 O |
| Smiles: | c1ccc(cc1)C(NC(C([Br])([Br])[Br])Nc1cccc2ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3565 |
| logD: | 4.8587 |
| logSw: | -6.8548 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 32.48 |
| InChI Key: | KNNKOJHOUSLGDZ-GOSISDBHSA-N |