5-{[5-(4-bromophenyl)furan-2-yl]methylidene}-3-(4-ethoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-{[5-(4-bromophenyl)furan-2-yl]methylidene}-3-(4-ethoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
5-{[5-(4-bromophenyl)furan-2-yl]methylidene}-3-(4-ethoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1503-0050 |
| Compound Name: | 5-{[5-(4-bromophenyl)furan-2-yl]methylidene}-3-(4-ethoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 486.4 |
| Molecular Formula: | C22 H16 Br N O3 S2 |
| Smiles: | CCOc1ccc(cc1)N1C(/C(=C\c2ccc(c3ccc(cc3)[Br])o2)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4619 |
| logD: | 6.4619 |
| logSw: | -5.7122 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 30.5243 |
| InChI Key: | GOIOWEGGIYGEPQ-UHFFFAOYSA-N |