N-[1-(4-bromoanilino)-2,2,2-trichloroethyl]-4-tert-butylbenzamide
Chemical Structure Depiction of
N-[1-(4-bromoanilino)-2,2,2-trichloroethyl]-4-tert-butylbenzamide
N-[1-(4-bromoanilino)-2,2,2-trichloroethyl]-4-tert-butylbenzamide
Compound characteristics
| Compound ID: | 1503-0783 |
| Compound Name: | N-[1-(4-bromoanilino)-2,2,2-trichloroethyl]-4-tert-butylbenzamide |
| Molecular Weight: | 478.64 |
| Molecular Formula: | C19 H20 Br Cl3 N2 O |
| Smiles: | CC(C)(C)c1ccc(cc1)C(NC(C([Cl])([Cl])[Cl])Nc1ccc(cc1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.8192 |
| logD: | 6.536 |
| logSw: | -6.5136 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 33.45 |
| InChI Key: | JFBHJQFVQAEIKG-QGZVFWFLSA-N |