5-({3-[(2,4-dichlorophenyl)methoxy]-4-methoxyphenyl}methylidene)-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-({3-[(2,4-dichlorophenyl)methoxy]-4-methoxyphenyl}methylidene)-1,3-diazinane-2,4,6-trione
5-({3-[(2,4-dichlorophenyl)methoxy]-4-methoxyphenyl}methylidene)-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 1538-0028 |
| Compound Name: | 5-({3-[(2,4-dichlorophenyl)methoxy]-4-methoxyphenyl}methylidene)-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 421.23 |
| Molecular Formula: | C19 H14 Cl2 N2 O5 |
| Smiles: | COc1ccc(C=C2C(NC(NC2=O)=O)=O)cc1OCc1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.0468 |
| logD: | 2.6996 |
| logSw: | -3.5841 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.588 |
| InChI Key: | CSLTYBHPPLEDOC-UHFFFAOYSA-N |