3,4-dichloro-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide
Chemical Structure Depiction of
3,4-dichloro-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide
3,4-dichloro-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | 1550-0826 |
| Compound Name: | 3,4-dichloro-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
| Molecular Weight: | 397.26 |
| Molecular Formula: | C21 H14 Cl2 N2 O2 |
| Smiles: | Cc1ccc2c(c1)oc(c1ccc(cc1)NC(c1ccc(c(c1)[Cl])[Cl])=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 6.1332 |
| logD: | 6.1315 |
| logSw: | -6.2951 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.14 |
| InChI Key: | RCOFZYNGVSSWPK-UHFFFAOYSA-N |