5-({4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl}methylidene)-3-(prop-2-en-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-({4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl}methylidene)-3-(prop-2-en-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one
5-({4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl}methylidene)-3-(prop-2-en-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1588-0278 |
| Compound Name: | 5-({4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl}methylidene)-3-(prop-2-en-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 431.96 |
| Molecular Formula: | C21 H18 Cl N O3 S2 |
| Smiles: | COc1cc(/C=C2/C(N(CC=C)C(=S)S2)=O)ccc1OCc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.0271 |
| logD: | 5.0271 |
| logSw: | -5.3563 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 31.637 |
| InChI Key: | CUXIXMQHPVSDDF-UHFFFAOYSA-N |