ethyl 2-[(5-hydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl)oxy]propanoate
Chemical Structure Depiction of
ethyl 2-[(5-hydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl)oxy]propanoate
ethyl 2-[(5-hydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl)oxy]propanoate
Compound characteristics
| Compound ID: | 1611-3154 |
| Compound Name: | ethyl 2-[(5-hydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl)oxy]propanoate |
| Molecular Weight: | 354.36 |
| Molecular Formula: | C20 H18 O6 |
| Smiles: | CCOC(C(C)Oc1cc(c2C(C=C(c3ccccc3)Oc2c1)=O)O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2841 |
| logD: | 4.2805 |
| logSw: | -4.169 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.876 |
| InChI Key: | NJRLEPKQVPCJJA-LBPRGKRZSA-N |