2-methoxy-1-nitronaphthalene
Chemical Structure Depiction of
2-methoxy-1-nitronaphthalene
2-methoxy-1-nitronaphthalene
Compound characteristics
| Compound ID: | 1615-0257 |
| Compound Name: | 2-methoxy-1-nitronaphthalene |
| Molecular Weight: | 203.19 |
| Molecular Formula: | C11 H9 N O3 |
| Smiles: | COc1ccc2ccccc2c1[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.1997 |
| logD: | 3.1997 |
| logSw: | -3.6849 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.377 |
| InChI Key: | XDNSKIDXVJNJFO-UHFFFAOYSA-N |