diethyl 2,6-dimethyl-4-(3-nitrophenyl)-1-phenyl-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
diethyl 2,6-dimethyl-4-(3-nitrophenyl)-1-phenyl-1,4-dihydropyridine-3,5-dicarboxylate
diethyl 2,6-dimethyl-4-(3-nitrophenyl)-1-phenyl-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | 1630-0095 |
| Compound Name: | diethyl 2,6-dimethyl-4-(3-nitrophenyl)-1-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 450.49 |
| Molecular Formula: | C25 H26 N2 O6 |
| Smiles: | CCOC(C1C(C(=C(C)N(C=1C)c1ccccc1)C(=O)OCC)c1cccc(c1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4356 |
| logD: | 4.4356 |
| logSw: | -4.3764 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 76.293 |
| InChI Key: | LFHRZSQXOCTFGJ-UHFFFAOYSA-N |