2-({[4-(dimethylamino)phenyl]methylidene}hydrazinylidene)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
2-({[4-(dimethylamino)phenyl]methylidene}hydrazinylidene)-1,3-thiazolidin-4-one
2-({[4-(dimethylamino)phenyl]methylidene}hydrazinylidene)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 1636-0400 |
| Compound Name: | 2-({[4-(dimethylamino)phenyl]methylidene}hydrazinylidene)-1,3-thiazolidin-4-one |
| Molecular Weight: | 262.33 |
| Molecular Formula: | C12 H14 N4 O S |
| Smiles: | CN(C)c1ccc(/C=N/N=C2/NC(CS2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.6023 |
| logD: | 1.3848 |
| logSw: | -2.4503 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.438 |
| InChI Key: | AOFVYOCIKCHIBD-UHFFFAOYSA-N |