N-[3-(2-{[4-(dimethylamino)phenyl]methylidene}hydrazinyl)-3-oxopropyl]benzamide
Chemical Structure Depiction of
N-[3-(2-{[4-(dimethylamino)phenyl]methylidene}hydrazinyl)-3-oxopropyl]benzamide
N-[3-(2-{[4-(dimethylamino)phenyl]methylidene}hydrazinyl)-3-oxopropyl]benzamide
Compound characteristics
| Compound ID: | 1643-0122 |
| Compound Name: | N-[3-(2-{[4-(dimethylamino)phenyl]methylidene}hydrazinyl)-3-oxopropyl]benzamide |
| Molecular Weight: | 338.41 |
| Molecular Formula: | C19 H22 N4 O2 |
| Smiles: | CN(C)c1ccc(/C=N/NC(CCNC(c2ccccc2)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.962 |
| logD: | 1.9614 |
| logSw: | -2.451 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.672 |
| InChI Key: | DKYJLEXSEWSVPJ-UHFFFAOYSA-N |