phenyl 8,10-dimethyl-2,6-bis(4-methylphenyl)-1,3,5,7-tetraoxododecahydro-4,8-ethenopyrrolo[3,4-f]isoindole-9-carboxylate
Chemical Structure Depiction of
phenyl 8,10-dimethyl-2,6-bis(4-methylphenyl)-1,3,5,7-tetraoxododecahydro-4,8-ethenopyrrolo[3,4-f]isoindole-9-carboxylate
phenyl 8,10-dimethyl-2,6-bis(4-methylphenyl)-1,3,5,7-tetraoxododecahydro-4,8-ethenopyrrolo[3,4-f]isoindole-9-carboxylate
Compound characteristics
| Compound ID: | 1650-0512 |
| Compound Name: | phenyl 8,10-dimethyl-2,6-bis(4-methylphenyl)-1,3,5,7-tetraoxododecahydro-4,8-ethenopyrrolo[3,4-f]isoindole-9-carboxylate |
| Molecular Weight: | 574.63 |
| Molecular Formula: | C35 H30 N2 O6 |
| Smiles: | CC1C2C3C(C(N(C3=O)c3ccc(C)cc3)=O)C(C)(C3C2C(N(C3=O)c2ccc(C)cc2)=O)C=1C(=O)Oc1ccccc1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.6392 |
| logD: | 3.6392 |
| logSw: | -3.9405 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 78.012 |
| InChI Key: | RMMFFTSIBUPKGR-UHFFFAOYSA-N |