2-bromo-1,5-dimethyl-3-nitrobenzene
Chemical Structure Depiction of
2-bromo-1,5-dimethyl-3-nitrobenzene
2-bromo-1,5-dimethyl-3-nitrobenzene
Compound characteristics
| Compound ID: | 1651-0039 |
| Compound Name: | 2-bromo-1,5-dimethyl-3-nitrobenzene |
| Molecular Weight: | 230.06 |
| Molecular Formula: | C8 H8 Br N O2 |
| Smiles: | Cc1cc(C)c(c(c1)[N+]([O-])=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 3.705 |
| logD: | 3.705 |
| logSw: | -4.1174 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.319 |
| InChI Key: | LOWKZDXVWHSOMU-UHFFFAOYSA-N |