(2-chlorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Chemical Structure Depiction of
(2-chlorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
(2-chlorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Compound characteristics
| Compound ID: | 1658-0112 |
| Compound Name: | (2-chlorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| Molecular Weight: | 274.7 |
| Molecular Formula: | C15 H11 Cl O3 |
| Smiles: | C1COc2cc(ccc2O1)C(c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.8312 |
| logD: | 2.8312 |
| logSw: | -3.7397 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.5286 |
| InChI Key: | ZYMLUQLZIRHDPQ-UHFFFAOYSA-N |