3-chloro-N-(5-{[4-(dimethylamino)phenyl]methylidene}-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide
Chemical Structure Depiction of
3-chloro-N-(5-{[4-(dimethylamino)phenyl]methylidene}-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide
3-chloro-N-(5-{[4-(dimethylamino)phenyl]methylidene}-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide
Compound characteristics
| Compound ID: | 1682-2038 |
| Compound Name: | 3-chloro-N-(5-{[4-(dimethylamino)phenyl]methylidene}-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide |
| Molecular Weight: | 417.93 |
| Molecular Formula: | C19 H16 Cl N3 O2 S2 |
| Smiles: | CN(C)c1ccc(/C=C2/C(N(C(=S)S2)NC(c2cccc(c2)[Cl])=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9294 |
| logD: | 3.7614 |
| logSw: | -4.5676 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.648 |
| InChI Key: | WGPADDOYDPUHBT-UHFFFAOYSA-N |