N-(3-acetylphenyl)-6-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)hexanamide
Chemical Structure Depiction of
N-(3-acetylphenyl)-6-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)hexanamide
N-(3-acetylphenyl)-6-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)hexanamide
Compound characteristics
| Compound ID: | 1682-2962 |
| Compound Name: | N-(3-acetylphenyl)-6-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)hexanamide |
| Molecular Weight: | 378.43 |
| Molecular Formula: | C22 H22 N2 O4 |
| Smiles: | CC(c1cccc(c1)NC(CCCCCN1C(c2ccccc2C1=O)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7632 |
| logD: | 2.7631 |
| logSw: | -3.4435 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.446 |
| InChI Key: | ZZVWHGLXBVGXDB-UHFFFAOYSA-N |