6-oxo-6H-dibenzo[b,d]pyran-3-yl 4-methoxybenzoate
Chemical Structure Depiction of
6-oxo-6H-dibenzo[b,d]pyran-3-yl 4-methoxybenzoate
6-oxo-6H-dibenzo[b,d]pyran-3-yl 4-methoxybenzoate
Compound characteristics
| Compound ID: | 1682-3350 |
| Compound Name: | 6-oxo-6H-dibenzo[b,d]pyran-3-yl 4-methoxybenzoate |
| Molecular Weight: | 346.34 |
| Molecular Formula: | C21 H14 O5 |
| Smiles: | COc1ccc(cc1)C(=O)Oc1ccc2c3ccccc3C(=O)Oc2c1 |
| Stereo: | ACHIRAL |
| logP: | 3.6554 |
| logD: | 3.6554 |
| logSw: | -4.8898 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 48.81 |
| InChI Key: | PGBJGBZWXNQASJ-UHFFFAOYSA-N |