butyl N-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)glycinate
Chemical Structure Depiction of
butyl N-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)glycinate
butyl N-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)glycinate
Compound characteristics
| Compound ID: | 1682-3374 |
| Compound Name: | butyl N-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)glycinate |
| Molecular Weight: | 242.23 |
| Molecular Formula: | C9 H14 N4 O4 |
| Smiles: | CCCCOC(CNC1C(NC(NN=1)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | -0.2539 |
| logD: | -1.4326 |
| logSw: | -1.0347 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 93.437 |
| InChI Key: | KXHBPRXHBKVNFH-UHFFFAOYSA-N |