N-[(3-chloro-2-methylphenyl)carbamothioyl]-3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
Chemical Structure Depiction of
N-[(3-chloro-2-methylphenyl)carbamothioyl]-3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
N-[(3-chloro-2-methylphenyl)carbamothioyl]-3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
Compound characteristics
| Compound ID: | 1682-7187 |
| Compound Name: | N-[(3-chloro-2-methylphenyl)carbamothioyl]-3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propanamide |
| Molecular Weight: | 401.87 |
| Molecular Formula: | C19 H16 Cl N3 O3 S |
| Smiles: | Cc1c(cccc1[Cl])NC(NC(CCN1C(c2ccccc2C1=O)=O)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 3.3753 |
| logD: | 3.3709 |
| logSw: | -3.7717 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.831 |
| InChI Key: | ZODNQJUCKOXFTA-UHFFFAOYSA-N |