butyl 4-(4-methylbenzamido)benzoate
Chemical Structure Depiction of
butyl 4-(4-methylbenzamido)benzoate
butyl 4-(4-methylbenzamido)benzoate
Compound characteristics
| Compound ID: | 1682-8049 |
| Compound Name: | butyl 4-(4-methylbenzamido)benzoate |
| Molecular Weight: | 311.38 |
| Molecular Formula: | C19 H21 N O3 |
| Smiles: | CCCCOC(c1ccc(cc1)NC(c1ccc(C)cc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0304 |
| logD: | 5.0263 |
| logSw: | -4.6441 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.377 |
| InChI Key: | JNJYUXLGFHHEIT-UHFFFAOYSA-N |