2-cyano-N'-[(3-nitrophenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-cyano-N'-[(3-nitrophenyl)methylidene]acetohydrazide
2-cyano-N'-[(3-nitrophenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 1682-9272 |
| Compound Name: | 2-cyano-N'-[(3-nitrophenyl)methylidene]acetohydrazide |
| Molecular Weight: | 232.2 |
| Molecular Formula: | C10 H8 N4 O3 |
| Smiles: | C(C#N)C(N/N=C/c1cccc(c1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.9732 |
| logD: | 0.9503 |
| logSw: | -2.3508 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 86.486 |
| InChI Key: | UCRRDFDZZFMXHI-KPKJPENVSA-N |