N'-[(4-chlorophenyl)methylidene]-2-(4-nitrophenoxy)acetohydrazide
Chemical Structure Depiction of
N'-[(4-chlorophenyl)methylidene]-2-(4-nitrophenoxy)acetohydrazide
N'-[(4-chlorophenyl)methylidene]-2-(4-nitrophenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 1682-9304 |
| Compound Name: | N'-[(4-chlorophenyl)methylidene]-2-(4-nitrophenoxy)acetohydrazide |
| Molecular Weight: | 333.73 |
| Molecular Formula: | C15 H12 Cl N3 O4 |
| Smiles: | C(C(N/N=C/c1ccc(cc1)[Cl])=O)Oc1ccc(cc1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.3199 |
| logD: | 3.3196 |
| logSw: | -4.0118 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.221 |
| InChI Key: | MHQQZXSDVZZKKC-UHFFFAOYSA-N |