ethyl 5-acetyl-2-(2,2-dimethylpropanamido)-4-methylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 5-acetyl-2-(2,2-dimethylpropanamido)-4-methylthiophene-3-carboxylate
ethyl 5-acetyl-2-(2,2-dimethylpropanamido)-4-methylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | 1683-0523 |
| Compound Name: | ethyl 5-acetyl-2-(2,2-dimethylpropanamido)-4-methylthiophene-3-carboxylate |
| Molecular Weight: | 311.4 |
| Molecular Formula: | C15 H21 N O4 S |
| Smiles: | CCOC(c1c(C)c(C(C)=O)sc1NC(C(C)(C)C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5956 |
| logD: | -0.5864 |
| logSw: | -2.8186 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.976 |
| InChI Key: | KWVPFZGFADNIEE-UHFFFAOYSA-N |